C17H18INOS — CID 7928343
(5R)-5-ethyl-N-(3-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 7928343) has the molecular formula C17H18INOS and a molecular weight of 411.31 g/mol. Its IUPAC name is (5R)-5-ethyl-N-(3-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5R)-5-ethyl-N-(3-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7928343 |
| Molecular Formula | C17H18INOS |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | (5R)-5-ethyl-N-(3-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC[C@@H]1CCc2sc(C(=O)Nc3cccc(I)c3)cc2C1 |
| InChI | InChI=1S/C17H18INOS/c1-2-11-6-7-15-12(8-11)9-16(21-15)17(20)19-14-5-3-4-13(18)10-14/h3-5,9-11H,2,6-8H2,1H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | HKMNYWCFMVYSNL-LLVKDONJSA-N |
| XLogP | 5.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|