C12H23NO3S — CID 74317793
dodeca-3,6-dienylsulfamic acid (PubChem CID 74317793) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is dodeca-3,6-dienylsulfamic acid.
| Compound Name | dodeca-3,6-dienylsulfamic acid |
|---|---|
| PubChem CID | 74317793 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | dodeca-3,6-dienylsulfamic acid |
| SMILES | CCCCCC=CCC=CCCNS(=O)(=O)O |
| InChI | InChI=1S/C12H23NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(14,15)16/h6-7,9-10,13H,2-5,8,11-12H2,1H3,(H,14,15,16) |
| InChIKey | DLEYFILNNFMARG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|