C25H26FN3O2 — CID 74318085
5-(4-fluorophenyl)-N-(2-hydroxycyclohexyl)-6-(2-pyridin-2-ylethyl)pyridine-3-carboxamide (PubChem CID 74318085) has the molecular formula C25H26FN3O2 and a molecular weight of 419.50 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(2-hydroxycyclohexyl)-6-(2-pyridin-2-ylethyl)pyridine-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(2-hydroxycyclohexyl)-6-(2-pyridin-2-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 74318085 |
| Molecular Formula | C25H26FN3O2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(2-hydroxycyclohexyl)-6-(2-pyridin-2-ylethyl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1O)c1cnc(CCc2ccccn2)c(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H26FN3O2/c26-19-10-8-17(9-11-19)21-15-18(25(31)29-23-6-1-2-7-24(23)30)16-28-22(21)13-12-20-5-3-4-14-27-20/h3-5,8-11,14-16,23-24,30H,1-2,6-7,12-13H2,(H,29,31) |
| InChIKey | PMXQYXQXRIQCSG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |