C22H23ClN2O3 — CID 67505408
5-(4-chlorophenyl)-N-[(2R)-2-hydroxycyclohexyl]-6-(3-methoxyprop-1-ynyl)pyridine-3-carboxamide (PubChem CID 67505408) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[(2R)-2-hydroxycyclohexyl]-6-(3-methoxyprop-1-ynyl)pyridine-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[(2R)-2-hydroxycyclohexyl]-6-(3-methoxyprop-1-ynyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67505408 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[(2R)-2-hydroxycyclohexyl]-6-(3-methoxyprop-1-ynyl)pyridine-3-carboxamide |
| SMILES | COCC#Cc1ncc(C(=O)NC2CCCC[C@H]2O)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O3/c1-28-12-4-6-19-18(15-8-10-17(23)11-9-15)13-16(14-24-19)22(27)25-20-5-2-3-7-21(20)26/h8-11,13-14,20-21,26H,2-3,5,7,12H2,1H3,(H,25,27)/t20?,21-/m1/s1 |
| InChIKey | VMGRSSARANEYCN-BPGUCPLFSA-N |
| XLogP | 3.43 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|