About 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide
5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide (PubChem CID 21109591) has the molecular formula C23H28Cl2N2O3
and a molecular weight of 451.39 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide |
| PubChem CID | 21109591 |
| Molecular Formula | C23H28Cl2N2O3 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide |
| SMILES | CCCCCOc1ncc(C(=O)NC2CCCCC2O)cc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H28Cl2N2O3/c1-2-3-6-11-30-23-18(17-10-9-16(24)13-19(17)25)12-15(14-26-23)22(29)27-20-7-4-5-8-21(20)28/h9-10,12-14,20-21,28H,2-8,11H2,1H3,(H,27,29) |
| InChIKey | KIFCAHLICSJHKR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide?
The IUPAC name of 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide (CID 21109591) is 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide.
What is the SMILES notation for 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide?
The canonical SMILES for 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide is CCCCCOc1ncc(C(=O)NC2CCCCC2O)cc1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide?
The InChIKey is KIFCAHLICSJHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28Cl2N2O3/c1-2-3-6-11-30-23-18(17-10-9-16(24)13-19(17)25)12-15(14-26-23)22(29)27-20-7-4-5-8-21(20)28/h9-10,12-14,20-21,28H,2-8,11H2,1H3,(H,27,29).
What are the key properties of 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide?
5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide has a molecular weight of 451.39 g/mol, XLogP of 5.66, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide is sourced from PubChem (CID 21109591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).