C23H28Cl2N2O3 — CID 21109591
5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide (PubChem CID 21109591) has the molecular formula C23H28Cl2N2O3 and a molecular weight of 451.39 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide.
| Compound Name | 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 21109591 |
| Molecular Formula | C23H28Cl2N2O3 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-(2-hydroxycyclohexyl)-6-pentoxypyridine-3-carboxamide |
| SMILES | CCCCCOc1ncc(C(=O)NC2CCCCC2O)cc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H28Cl2N2O3/c1-2-3-6-11-30-23-18(17-10-9-16(24)13-19(17)25)12-15(14-26-23)22(29)27-20-7-4-5-8-21(20)28/h9-10,12-14,20-21,28H,2-8,11H2,1H3,(H,27,29) |
| InChIKey | KIFCAHLICSJHKR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|