C23H26F4N2O3 — CID 21109649
6-butoxy-5-[2-fluoro-5-(trifluoromethyl)phenyl]-N-(2-hydroxycyclohexyl)pyridine-3-carboxamide (PubChem CID 21109649) has the molecular formula C23H26F4N2O3 and a molecular weight of 454.46 g/mol. Its IUPAC name is 6-butoxy-5-[2-fluoro-5-(trifluoromethyl)phenyl]-N-(2-hydroxycyclohexyl)pyridine-3-carboxamide.
| Compound Name | 6-butoxy-5-[2-fluoro-5-(trifluoromethyl)phenyl]-N-(2-hydroxycyclohexyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 21109649 |
| Molecular Formula | C23H26F4N2O3 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 6-butoxy-5-[2-fluoro-5-(trifluoromethyl)phenyl]-N-(2-hydroxycyclohexyl)pyridine-3-carboxamide |
| SMILES | CCCCOc1ncc(C(=O)NC2CCCCC2O)cc1-c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C23H26F4N2O3/c1-2-3-10-32-22-17(16-12-15(23(25,26)27)8-9-18(16)24)11-14(13-28-22)21(31)29-19-6-4-5-7-20(19)30/h8-9,11-13,19-20,30H,2-7,10H2,1H3,(H,29,31) |
| InChIKey | GNEASUXYOFAFSW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|