C25H30ClN3O4 — CID 67505011
5-(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-[3-(2-oxopyrrolidin-1-yl)propoxy]pyridine-3-carboxamide (PubChem CID 67505011) has the molecular formula C25H30ClN3O4 and a molecular weight of 471.99 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-[3-(2-oxopyrrolidin-1-yl)propoxy]pyridine-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-[3-(2-oxopyrrolidin-1-yl)propoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67505011 |
| Molecular Formula | C25H30ClN3O4 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-[3-(2-oxopyrrolidin-1-yl)propoxy]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1cnc(OCCCN2CCCC2=O)c(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H30ClN3O4/c26-19-10-8-17(9-11-19)20-15-18(24(32)28-21-5-1-2-6-22(21)30)16-27-25(20)33-14-4-13-29-12-3-7-23(29)31/h8-11,15-16,21-22,30H,1-7,12-14H2,(H,28,32)/t21-,22-/m1/s1 |
| InChIKey | YWGPMRRXYWNOHT-FGZHOGPDSA-N |
| XLogP | 3.83 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|