C21H20N6Na2O5 — CID 74336147
disodium;2-[[4-[2-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate (PubChem CID 74336147) has the molecular formula C21H20N6Na2O5 and a molecular weight of 482.41 g/mol. Its IUPAC name is disodium;2-[[4-[2-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate.
| Compound Name | disodium;2-[[4-[2-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate |
|---|---|
| PubChem CID | 74336147 |
| Molecular Formula | C21H20N6Na2O5 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | disodium;2-[[4-[2-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate |
| SMILES | C=C(CC(NC(=O)c1ccc(CCc2c[nH]c3nc(N)nc(N)c23)cc1)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C21H22N6O5.2Na/c1-10(19(29)30)8-14(20(31)32)25-18(28)12-5-2-11(3-6-12)4-7-13-9-24-17-15(13)16(22)26-21(23)27-17;;/h2-3,5-6,9,14H,1,4,7-8H2,(H,25,28)(H,29,30)(H,31,32)(H5,22,23,24,26,27);;/q;2*+1/p-2 |
| InChIKey | DAZNOEOJTNADBJ-UHFFFAOYSA-L |
| XLogP | -7.54 |
| TPSA | 202.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | -7.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|