C20H22N2O5 — CID 7433764
[2-[(2-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-acetamidobenzoate (PubChem CID 7433764) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-acetamidobenzoate.
| Compound Name | [2-[(2-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-acetamidobenzoate |
|---|---|
| PubChem CID | 7433764 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [2-[(2-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-acetamidobenzoate |
| SMILES | COc1ccccc1CN(C)C(=O)COC(=O)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-14(23)21-17-9-6-8-15(11-17)20(25)27-13-19(24)22(2)12-16-7-4-5-10-18(16)26-3/h4-11H,12-13H2,1-3H3,(H,21,23) |
| InChIKey | QNOORZNJQATBAE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |