C12H21N — CID 74340628
8-methyl-5-propyl-1,2,3,5,8,8a-hexahydroindolizine (PubChem CID 74340628) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 8-methyl-5-propyl-1,2,3,5,8,8a-hexahydroindolizine.
| Compound Name | 8-methyl-5-propyl-1,2,3,5,8,8a-hexahydroindolizine |
|---|---|
| PubChem CID | 74340628 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 8-methyl-5-propyl-1,2,3,5,8,8a-hexahydroindolizine |
| SMILES | CCCC1C=CC(C)C2CCCN12 |
| InChI | InChI=1S/C12H21N/c1-3-5-11-8-7-10(2)12-6-4-9-13(11)12/h7-8,10-12H,3-6,9H2,1-2H3 |
| InChIKey | IBFXDDXLJQDSFV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|