C9H13N — CID 20687664
1-Methyl-2,3,3a,7a-tetrahydroindole (PubChem CID 20687664) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 1-methyl-2,3,3a,7a-tetrahydroindole.
| Compound Name | 1-Methyl-2,3,3a,7a-tetrahydroindole |
|---|---|
| PubChem CID | 20687664 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 1-methyl-2,3,3a,7a-tetrahydroindole |
| SMILES | CN1CCC2C1C=CC=C2 |
| InChI | InChI=1S/C9H13N/c1-10-7-6-8-4-2-3-5-9(8)10/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | WDCVFQCRTQAURA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | 181 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |