C10H11N — CID 91051298
2-azatricyclo[6.2.1.02,7]undeca-4,6,9-triene (PubChem CID 91051298) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-azatricyclo[6.2.1.02,7]undeca-4,6,9-triene.
| Compound Name | 2-azatricyclo[6.2.1.02,7]undeca-4,6,9-triene |
|---|---|
| PubChem CID | 91051298 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-azatricyclo[6.2.1.02,7]undeca-4,6,9-triene |
| SMILES | C1=CCN2C(=C1)C1C=CC2C1 |
| InChI | InChI=1S/C10H11N/c1-2-6-11-9-5-4-8(7-9)10(11)3-1/h1-5,8-9H,6-7H2 |
| InChIKey | ITZMWZALCLXJQJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|