C31H48O3 — CID 74348235
15-(7,7-dimethyl-6-oxabicyclo[3.2.1]octan-4-yl)-6-hydroxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-5-one (PubChem CID 74348235) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is 15-(7,7-dimethyl-6-oxabicyclo[3.2.1]octan-4-yl)-6-hydroxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-5-one.
| Compound Name | 15-(7,7-dimethyl-6-oxabicyclo[3.2.1]octan-4-yl)-6-hydroxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-5-one |
|---|---|
| PubChem CID | 74348235 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | 15-(7,7-dimethyl-6-oxabicyclo[3.2.1]octan-4-yl)-6-hydroxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-5-one |
| SMILES | CC1(C)OC2CC1CCC2C1CCC2(C)C3CCC4C(C)(C)C(O)C(=O)CC45CC35CCC12C |
| InChI | InChI=1S/C31H48O3/c1-26(2)23-9-10-24-29(6)12-11-20(19-8-7-18-15-22(19)34-27(18,3)4)28(29,5)13-14-30(24)17-31(23,30)16-21(32)25(26)33/h18-20,22-25,33H,7-17H2,1-6H3 |
| InChIKey | YLLSLJJPDKOBCA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |