C27H25NO5S — CID 74349688
2-[[4-[4-[2-(1-benzofuran-2-yl)ethenyl]phenyl]phenyl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 74349688) has the molecular formula C27H25NO5S and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-[[4-[4-[2-(1-benzofuran-2-yl)ethenyl]phenyl]phenyl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-[4-[2-(1-benzofuran-2-yl)ethenyl]phenyl]phenyl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 74349688 |
| Molecular Formula | C27H25NO5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-[[4-[4-[2-(1-benzofuran-2-yl)ethenyl]phenyl]phenyl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(-c2ccc(C=Cc3cc4ccccc4o3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H25NO5S/c1-18(2)26(27(29)30)28-34(31,32)24-15-12-21(13-16-24)20-10-7-19(8-11-20)9-14-23-17-22-5-3-4-6-25(22)33-23/h3-18,26,28H,1-2H3,(H,29,30) |
| InChIKey | NNCMZAJUJIFSSX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |