C12H23N2O3+ — CID 7437115
[(2R)-oxolan-2-yl]methyl-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]azanium (PubChem CID 7437115) has the molecular formula C12H23N2O3+ and a molecular weight of 243.33 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]azanium.
| Compound Name | [(2R)-oxolan-2-yl]methyl-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]azanium |
|---|---|
| PubChem CID | 7437115 |
| Molecular Formula | C12H23N2O3+ |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]azanium |
| SMILES | O=C(C[NH2+]C[C@H]1CCCO1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C12H22N2O3/c15-12(14-8-11-4-2-6-17-11)9-13-7-10-3-1-5-16-10/h10-11,13H,1-9H2,(H,14,15)/p+1/t10-,11+/m1/s1 |
| InChIKey | VGQDCTHHWXJXJC-MNOVXSKESA-O |
| XLogP | -0.98 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |