C21H15F6N3O2 — CID 74394698
2-amino-3-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-N-(2,4,5-trifluorophenyl)propanamide (PubChem CID 74394698) has the molecular formula C21H15F6N3O2 and a molecular weight of 455.36 g/mol. Its IUPAC name is 2-amino-3-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-N-(2,4,5-trifluorophenyl)propanamide.
| Compound Name | 2-amino-3-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-N-(2,4,5-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 74394698 |
| Molecular Formula | C21H15F6N3O2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-amino-3-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-N-(2,4,5-trifluorophenyl)propanamide |
| SMILES | NC(Cc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1)C(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H15F6N3O2/c22-14-8-16(24)18(9-15(14)23)30-20(31)17(28)7-11-1-4-13(5-2-11)32-19-6-3-12(10-29-19)21(25,26)27/h1-6,8-10,17H,7,28H2,(H,30,31) |
| InChIKey | CWIPVZSFCFDIJM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|