C24H28O10 — CID 74396823
2-[1,8-dihydroxy-7-[5-(5-hydroxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]-3,4-dioxonaphthalen-2-yl]acetic acid (PubChem CID 74396823) has the molecular formula C24H28O10 and a molecular weight of 476.48 g/mol. Its IUPAC name is 2-[1,8-dihydroxy-7-[5-(5-hydroxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]-3,4-dioxonaphthalen-2-yl]acetic acid.
| Compound Name | 2-[1,8-dihydroxy-7-[5-(5-hydroxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]-3,4-dioxonaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 74396823 |
| Molecular Formula | C24H28O10 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-[1,8-dihydroxy-7-[5-(5-hydroxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]-3,4-dioxonaphthalen-2-yl]acetic acid |
| SMILES | CC1OC(OC2CCC(c3ccc4c(c3O)C(O)=C(CC(=O)O)C(=O)C4=O)OC2C)CCC1O |
| InChI | InChI=1S/C24H28O10/c1-10-15(25)5-8-19(33-10)34-16-6-7-17(32-11(16)2)12-3-4-13-20(21(12)28)22(29)14(9-18(26)27)24(31)23(13)30/h3-4,10-11,15-17,19,25,28-29H,5-9H2,1-2H3,(H,26,27) |
| InChIKey | VLGJXBGIKMRIEV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|