C25H38O7 — CID 102291667
(2R,3S,6R)-2-methyl-6-[(2R,3S,6R)-2-methyl-6-[(2R,3S,6S)-2-methyl-6-phenylmethoxyoxan-3-yl]oxyoxan-3-yl]oxyoxan-3-ol (PubChem CID 102291667) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is (2R,3S,6R)-2-methyl-6-[(2R,3S,6R)-2-methyl-6-[(2R,3S,6S)-2-methyl-6-phenylmethoxyoxan-3-yl]oxyoxan-3-yl]oxyoxan-3-ol.
| Compound Name | (2R,3S,6R)-2-methyl-6-[(2R,3S,6R)-2-methyl-6-[(2R,3S,6S)-2-methyl-6-phenylmethoxyoxan-3-yl]oxyoxan-3-yl]oxyoxan-3-ol |
|---|---|
| PubChem CID | 102291667 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (2R,3S,6R)-2-methyl-6-[(2R,3S,6R)-2-methyl-6-[(2R,3S,6S)-2-methyl-6-phenylmethoxyoxan-3-yl]oxyoxan-3-yl]oxyoxan-3-ol |
| SMILES | C[C@H]1O[C@H](OCc2ccccc2)CC[C@@H]1O[C@@H]1CC[C@H](O[C@@H]2CC[C@H](O)[C@@H](C)O2)[C@@H](C)O1 |
| InChI | InChI=1S/C25H38O7/c1-16-20(26)9-12-24(28-16)31-22-11-14-25(30-18(22)3)32-21-10-13-23(29-17(21)2)27-15-19-7-5-4-6-8-19/h4-8,16-18,20-26H,9-15H2,1-3H3/t16-,17-,18-,20+,21+,22+,23+,24-,25-/m1/s1 |
| InChIKey | DDFCTDOMVGTAGY-RDVJXYLVSA-N |
| XLogP | 3.91 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |