C18H20O6 — CID 74396923
3,15-dihydroxy-9-methyl-8,19-dioxatricyclo[13.3.1.05,18]nonadeca-1,3,5(18),13-tetraene-7,17-dione (PubChem CID 74396923) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 3,15-dihydroxy-9-methyl-8,19-dioxatricyclo[13.3.1.05,18]nonadeca-1,3,5(18),13-tetraene-7,17-dione.
| Compound Name | 3,15-dihydroxy-9-methyl-8,19-dioxatricyclo[13.3.1.05,18]nonadeca-1,3,5(18),13-tetraene-7,17-dione |
|---|---|
| PubChem CID | 74396923 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3,15-dihydroxy-9-methyl-8,19-dioxatricyclo[13.3.1.05,18]nonadeca-1,3,5(18),13-tetraene-7,17-dione |
| SMILES | CC1CCCC=CC2(O)CC(=O)c3c(cc(O)cc3O2)CC(=O)O1 |
| InChI | InChI=1S/C18H20O6/c1-11-5-3-2-4-6-18(22)10-14(20)17-12(8-16(21)23-11)7-13(19)9-15(17)24-18/h4,6-7,9,11,19,22H,2-3,5,8,10H2,1H3 |
| InChIKey | NXIOMVOFGLOKLL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|