C20H26O8S — CID 102231640
methyl (2R)-3-[[(5S,9S)-13,15-dihydroxy-5-methyl-3,11-dioxo-4-oxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-9-yl]sulfanyl]-2-hydroxypropanoate (PubChem CID 102231640) has the molecular formula C20H26O8S and a molecular weight of 426.49 g/mol. Its IUPAC name is methyl (2R)-3-[[(5S,9S)-13,15-dihydroxy-5-methyl-3,11-dioxo-4-oxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-9-yl]sulfanyl]-2-hydroxypropanoate.
| Compound Name | methyl (2R)-3-[[(5S,9S)-13,15-dihydroxy-5-methyl-3,11-dioxo-4-oxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-9-yl]sulfanyl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 102231640 |
| Molecular Formula | C20H26O8S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | methyl (2R)-3-[[(5S,9S)-13,15-dihydroxy-5-methyl-3,11-dioxo-4-oxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-9-yl]sulfanyl]-2-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](O)CS[C@H]1CCC[C@H](C)OC(=O)Cc2cc(O)cc(O)c2C(=O)C1 |
| InChI | InChI=1S/C20H26O8S/c1-11-4-3-5-14(29-10-17(24)20(26)27-2)9-16(23)19-12(7-18(25)28-11)6-13(21)8-15(19)22/h6,8,11,14,17,21-22,24H,3-5,7,9-10H2,1-2H3/t11-,14-,17-/m0/s1 |
| InChIKey | YXJPFYMQMMDSJU-YLVFBTJISA-N |
| XLogP | 1.96 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |