C12H10Cl3NO3 — CID 74397543
methyl 5-methyl-3-(2,3,6-trichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carboxylate (PubChem CID 74397543) has the molecular formula C12H10Cl3NO3 and a molecular weight of 322.58 g/mol. Its IUPAC name is methyl 5-methyl-3-(2,3,6-trichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 5-methyl-3-(2,3,6-trichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 74397543 |
| Molecular Formula | C12H10Cl3NO3 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | methyl 5-methyl-3-(2,3,6-trichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)C1C(c2c(Cl)ccc(Cl)c2Cl)=NOC1C |
| InChI | InChI=1S/C12H10Cl3NO3/c1-5-8(12(17)18-2)11(16-19-5)9-6(13)3-4-7(14)10(9)15/h3-5,8H,1-2H3 |
| InChIKey | UTAQYOFFTVUIAB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|