About [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate
[(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate (PubChem CID 7439958) has the molecular formula C18H15FO5
and a molecular weight of 330.31 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate.
Molecular Properties
| Compound Name | [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate |
| PubChem CID | 7439958 |
| Molecular Formula | C18H15FO5 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate |
| SMILES | O=C(O[C@@H]1CCOC1=O)c1ccccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FO5/c19-13-7-5-12(6-8-13)11-23-15-4-2-1-3-14(15)17(20)24-16-9-10-22-18(16)21/h1-8,16H,9-11H2/t16-/m1/s1 |
| InChIKey | CVLNKTFOPAHMCX-MRXNPFEDSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate?
The IUPAC name of [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate (CID 7439958) is [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate.
What is the SMILES notation for [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate?
The canonical SMILES for [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate is O=C(O[C@@H]1CCOC1=O)c1ccccc1OCc1ccc(F)cc1.
What is the InChIKey of [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate?
The InChIKey is CVLNKTFOPAHMCX-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H15FO5/c19-13-7-5-12(6-8-13)11-23-15-4-2-1-3-14(15)17(20)24-16-9-10-22-18(16)21/h1-8,16H,9-11H2/t16-/m1/s1.
What are the key properties of [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate?
[(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate has a molecular weight of 330.31 g/mol, XLogP of 2.88, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-2-oxooxolan-3-yl] 2-[(4-fluorophenyl)methoxy]benzoate is sourced from PubChem (CID 7439958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).