C25H29N2O2+ — CID 7440782
1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phenylpiperazin-1-ium (PubChem CID 7440782) has the molecular formula C25H29N2O2+ and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phenylpiperazin-1-ium.
| Compound Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phenylpiperazin-1-ium |
|---|---|
| PubChem CID | 7440782 |
| Molecular Formula | C25H29N2O2+ |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phenylpiperazin-1-ium |
| SMILES | COc1cc(C[NH+]2CCN(c3ccccc3)CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H28N2O2/c1-28-25-18-22(12-13-24(25)29-20-21-8-4-2-5-9-21)19-26-14-16-27(17-15-26)23-10-6-3-7-11-23/h2-13,18H,14-17,19-20H2,1H3/p+1 |
| InChIKey | INYOSINQIJOQKT-UHFFFAOYSA-O |
| XLogP | 3.18 |
| TPSA | 26.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |