C25H28FN2O2+ — CID 7441126
1-(2-fluorophenyl)-4-[(4-methoxy-3-phenylmethoxyphenyl)methyl]piperazin-4-ium (PubChem CID 7441126) has the molecular formula C25H28FN2O2+ and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[(4-methoxy-3-phenylmethoxyphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(2-fluorophenyl)-4-[(4-methoxy-3-phenylmethoxyphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 7441126 |
| Molecular Formula | C25H28FN2O2+ |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[(4-methoxy-3-phenylmethoxyphenyl)methyl]piperazin-4-ium |
| SMILES | COc1ccc(C[NH+]2CCN(c3ccccc3F)CC2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C25H27FN2O2/c1-29-24-12-11-21(17-25(24)30-19-20-7-3-2-4-8-20)18-27-13-15-28(16-14-27)23-10-6-5-9-22(23)26/h2-12,17H,13-16,18-19H2,1H3/p+1 |
| InChIKey | WSNGMCJYSLUZDS-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 26.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |