C22H36O2Si — CID 74425605
cyclohexen-1-yloxy-(6-methyl-3-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl)oxy-di(propan-2-yl)silane (PubChem CID 74425605) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is cyclohexen-1-yloxy-(6-methyl-3-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl)oxy-di(propan-2-yl)silane.
| Compound Name | cyclohexen-1-yloxy-(6-methyl-3-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl)oxy-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 74425605 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | cyclohexen-1-yloxy-(6-methyl-3-prop-1-en-2-ylcyclohexa-1,5-dien-1-yl)oxy-di(propan-2-yl)silane |
| SMILES | C=C(C)C1C=C(O[Si](OC2=CCCCC2)(C(C)C)C(C)C)C(C)=CC1 |
| InChI | InChI=1S/C22H36O2Si/c1-16(2)20-14-13-19(7)22(15-20)24-25(17(3)4,18(5)6)23-21-11-9-8-10-12-21/h11,13,15,17-18,20H,1,8-10,12,14H2,2-7H3 |
| InChIKey | QINBGRCIRNBOMN-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|