About methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate
methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate (PubChem CID 74447319) has the molecular formula C10H7NO5
and a molecular weight of 221.17 g/mol. Its IUPAC name is methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate.
Molecular Properties
| Compound Name | methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate |
| PubChem CID | 74447319 |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate |
| SMILES | COC(=O)C1C=CC=C2C(=O)OC(=O)N=C21 |
| InChI | InChI=1S/C10H7NO5/c1-15-8(12)5-3-2-4-6-7(5)11-10(14)16-9(6)13/h2-5H,1H3 |
| InChIKey | BLKBUECAJRFEQL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate?
The IUPAC name of methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate (CID 74447319) is methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate.
What is the SMILES notation for methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate?
The canonical SMILES for methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate is COC(=O)C1C=CC=C2C(=O)OC(=O)N=C21.
What is the InChIKey of methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate?
The InChIKey is BLKBUECAJRFEQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO5/c1-15-8(12)5-3-2-4-6-7(5)11-10(14)16-9(6)13/h2-5H,1H3.
What are the key properties of methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate?
methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate has a molecular weight of 221.17 g/mol, XLogP of 0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylate is sourced from PubChem (CID 74447319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).