C9H5NO5 — CID 74813862
2,4-dioxo-8H-3,1-benzoxazine-8-carboxylic acid (PubChem CID 74813862) has the molecular formula C9H5NO5 and a molecular weight of 207.14 g/mol. Its IUPAC name is 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylic acid.
| Compound Name | 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylic acid |
|---|---|
| PubChem CID | 74813862 |
| Molecular Formula | C9H5NO5 |
| Molecular Weight | 207.14 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 2,4-dioxo-8H-3,1-benzoxazine-8-carboxylic acid |
| SMILES | O=C1N=C2C(=CC=CC2C(=O)O)C(=O)O1 |
| InChI | InChI=1S/C9H5NO5/c11-7(12)4-2-1-3-5-6(4)10-9(14)15-8(5)13/h1-4H,(H,11,12) |
| InChIKey | ODHPDDRBCMDYBE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.14 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|