C12H16FN2O+ — CID 7447150
4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-ium-5-one (PubChem CID 7447150) has the molecular formula C12H16FN2O+ and a molecular weight of 223.27 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-ium-5-one.
| Compound Name | 4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-ium-5-one |
|---|---|
| PubChem CID | 7447150 |
| Molecular Formula | C12H16FN2O+ |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-ium-5-one |
| SMILES | O=C1CC[NH2+]CCN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H15FN2O/c13-11-3-1-2-10(8-11)9-15-7-6-14-5-4-12(15)16/h1-3,8,14H,4-7,9H2/p+1 |
| InChIKey | HCGHYJUSFLXCJH-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |