C23H21NO4 — CID 7447154
methyl (4S)-4-(2-ethoxyphenyl)-2-methyl-5-oxo-4,4a-dihydroindeno[1,2-b]pyridine-3-carboxylate (PubChem CID 7447154) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is methyl (4S)-4-(2-ethoxyphenyl)-2-methyl-5-oxo-4,4a-dihydroindeno[1,2-b]pyridine-3-carboxylate.
| Compound Name | methyl (4S)-4-(2-ethoxyphenyl)-2-methyl-5-oxo-4,4a-dihydroindeno[1,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 7447154 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | methyl (4S)-4-(2-ethoxyphenyl)-2-methyl-5-oxo-4,4a-dihydroindeno[1,2-b]pyridine-3-carboxylate |
| SMILES | CCOc1ccccc1[C@H]1C(C(=O)OC)=C(C)N=C2c3ccccc3C(=O)C21 |
| InChI | InChI=1S/C23H21NO4/c1-4-28-17-12-8-7-11-16(17)19-18(23(26)27-3)13(2)24-21-14-9-5-6-10-15(14)22(25)20(19)21/h5-12,19-20H,4H2,1-3H3/t19-,20?/m0/s1 |
| InChIKey | RDFVJLHFDJAVMN-XJDOXCRVSA-N |
| XLogP | 3.93 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_B(1)', 'substructure': 'N/A'} |
|---|