C17H23N2O+ — CID 7447307
cyclohexyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]azanium (PubChem CID 7447307) has the molecular formula C17H23N2O+ and a molecular weight of 271.38 g/mol. Its IUPAC name is cyclohexyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]azanium.
| Compound Name | cyclohexyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 7447307 |
| Molecular Formula | C17H23N2O+ |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | cyclohexyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]azanium |
| SMILES | Cc1ccc2[nH]c(=O)c(C[NH2+]C3CCCCC3)cc2c1 |
| InChI | InChI=1S/C17H22N2O/c1-12-7-8-16-13(9-12)10-14(17(20)19-16)11-18-15-5-3-2-4-6-15/h7-10,15,18H,2-6,11H2,1H3,(H,19,20)/p+1 |
| InChIKey | GXYYOVFUIVCZJR-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 49.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |