C22H31N3O2 — CID 95103351
N-[2-[(2S)-2-ethylpiperidin-1-yl]ethyl]-3-(6-methyl-2-oxo-1H-quinolin-3-yl)propanamide (PubChem CID 95103351) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[2-[(2S)-2-ethylpiperidin-1-yl]ethyl]-3-(6-methyl-2-oxo-1H-quinolin-3-yl)propanamide.
| Compound Name | N-[2-[(2S)-2-ethylpiperidin-1-yl]ethyl]-3-(6-methyl-2-oxo-1H-quinolin-3-yl)propanamide |
|---|---|
| PubChem CID | 95103351 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | N-[2-[(2S)-2-ethylpiperidin-1-yl]ethyl]-3-(6-methyl-2-oxo-1H-quinolin-3-yl)propanamide |
| SMILES | CC[C@H]1CCCCN1CCNC(=O)CCc1cc2cc(C)ccc2[nH]c1=O |
| InChI | InChI=1S/C22H31N3O2/c1-3-19-6-4-5-12-25(19)13-11-23-21(26)10-8-17-15-18-14-16(2)7-9-20(18)24-22(17)27/h7,9,14-15,19H,3-6,8,10-13H2,1-2H3,(H,23,26)(H,24,27)/t19-/m0/s1 |
| InChIKey | YUHJNFUSXXIYML-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |