C22H31N3O3 — CID 95103360
N-[2-[(2R)-2-ethylpiperidin-1-yl]ethyl]-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanamide (PubChem CID 95103360) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[2-[(2R)-2-ethylpiperidin-1-yl]ethyl]-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanamide.
| Compound Name | N-[2-[(2R)-2-ethylpiperidin-1-yl]ethyl]-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanamide |
|---|---|
| PubChem CID | 95103360 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[2-[(2R)-2-ethylpiperidin-1-yl]ethyl]-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanamide |
| SMILES | CC[C@@H]1CCCCN1CCNC(=O)CCc1cc2cc(OC)ccc2[nH]c1=O |
| InChI | InChI=1S/C22H31N3O3/c1-3-18-6-4-5-12-25(18)13-11-23-21(26)10-7-16-14-17-15-19(28-2)8-9-20(17)24-22(16)27/h8-9,14-15,18H,3-7,10-13H2,1-2H3,(H,23,26)(H,24,27)/t18-/m1/s1 |
| InChIKey | KFHBUYVWACTMHN-GOSISDBHSA-N |
| XLogP | 2.85 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |