C28H35FN4O3 — CID 74498971
5-[[[3-[2-[4-[3-(3-fluorophenyl)prop-2-enoyl]piperazin-1-yl]ethoxy]phenyl]methyl-methylamino]methyl]pyrrolidin-2-one (PubChem CID 74498971) has the molecular formula C28H35FN4O3 and a molecular weight of 494.61 g/mol. Its IUPAC name is 5-[[[3-[2-[4-[3-(3-fluorophenyl)prop-2-enoyl]piperazin-1-yl]ethoxy]phenyl]methyl-methylamino]methyl]pyrrolidin-2-one.
| Compound Name | 5-[[[3-[2-[4-[3-(3-fluorophenyl)prop-2-enoyl]piperazin-1-yl]ethoxy]phenyl]methyl-methylamino]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 74498971 |
| Molecular Formula | C28H35FN4O3 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 5-[[[3-[2-[4-[3-(3-fluorophenyl)prop-2-enoyl]piperazin-1-yl]ethoxy]phenyl]methyl-methylamino]methyl]pyrrolidin-2-one |
| SMILES | CN(Cc1cccc(OCCN2CCN(C(=O)C=Cc3cccc(F)c3)CC2)c1)CC1CCC(=O)N1 |
| InChI | InChI=1S/C28H35FN4O3/c1-31(21-25-9-10-27(34)30-25)20-23-5-3-7-26(19-23)36-17-16-32-12-14-33(15-13-32)28(35)11-8-22-4-2-6-24(29)18-22/h2-8,11,18-19,25H,9-10,12-17,20-21H2,1H3,(H,30,34) |
| InChIKey | XYVRBXIAFKNGQA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|