C22H22F2N2O3 — CID 74501370
1-[3-(2,4-difluorophenyl)prop-2-enoyl]-4-[(3-methoxyphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 74501370) has the molecular formula C22H22F2N2O3 and a molecular weight of 400.43 g/mol. Its IUPAC name is 1-[3-(2,4-difluorophenyl)prop-2-enoyl]-4-[(3-methoxyphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(2,4-difluorophenyl)prop-2-enoyl]-4-[(3-methoxyphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 74501370 |
| Molecular Formula | C22H22F2N2O3 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-[3-(2,4-difluorophenyl)prop-2-enoyl]-4-[(3-methoxyphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | COc1cccc(CN2CCN(C(=O)C=Cc3ccc(F)cc3F)CCC2=O)c1 |
| InChI | InChI=1S/C22H22F2N2O3/c1-29-19-4-2-3-16(13-19)15-26-12-11-25(10-9-22(26)28)21(27)8-6-17-5-7-18(23)14-20(17)24/h2-8,13-14H,9-12,15H2,1H3 |
| InChIKey | NEVVEZMDYGLTIJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|