C27H28N2O4 — CID 171134729
1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(naphthalen-2-ylmethyl)-1,4-diazepan-5-one (PubChem CID 171134729) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(naphthalen-2-ylmethyl)-1,4-diazepan-5-one.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(naphthalen-2-ylmethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 171134729 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(naphthalen-2-ylmethyl)-1,4-diazepan-5-one |
| SMILES | COc1ccc(C=CC(=O)N2CCC(=O)N(Cc3ccc4ccccc4c3)CC2)cc1OC |
| InChI | InChI=1S/C27H28N2O4/c1-32-24-11-8-20(18-25(24)33-2)9-12-26(30)28-14-13-27(31)29(16-15-28)19-21-7-10-22-5-3-4-6-23(22)17-21/h3-12,17-18H,13-16,19H2,1-2H3 |
| InChIKey | WUOMJRWSLOISIT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|