C22H27N3O2 — CID 74503085
1-(3-benzhydryl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-methoxyethanone (PubChem CID 74503085) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-(3-benzhydryl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-methoxyethanone.
| Compound Name | 1-(3-benzhydryl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-methoxyethanone |
|---|---|
| PubChem CID | 74503085 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-(3-benzhydryl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC2NNC(C(c3ccccc3)c3ccccc3)C2C1 |
| InChI | InChI=1S/C22H27N3O2/c1-27-15-20(26)25-13-12-19-18(14-25)22(24-23-19)21(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18-19,21-24H,12-15H2,1H3 |
| InChIKey | WLSXAQNFEFSYKQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |