C20H22FN3OS — CID 74559067
1-[3-(2-fluorophenyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenylsulfanylethanone (PubChem CID 74559067) has the molecular formula C20H22FN3OS and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-[3-(2-fluorophenyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenylsulfanylethanone.
| Compound Name | 1-[3-(2-fluorophenyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 74559067 |
| Molecular Formula | C20H22FN3OS |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[3-(2-fluorophenyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenylsulfanylethanone |
| SMILES | O=C(CSc1ccccc1)N1CCC2NNC(c3ccccc3F)C2C1 |
| InChI | InChI=1S/C20H22FN3OS/c21-17-9-5-4-8-15(17)20-16-12-24(11-10-18(16)22-23-20)19(25)13-26-14-6-2-1-3-7-14/h1-9,16,18,20,22-23H,10-13H2 |
| InChIKey | NAWNFWRMJOWFEE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |