C18H26N4O2S — CID 85481208
morpholin-4-yl-[3-(phenylsulfanylmethyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]methanone (PubChem CID 85481208) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is morpholin-4-yl-[3-(phenylsulfanylmethyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]methanone.
| Compound Name | morpholin-4-yl-[3-(phenylsulfanylmethyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 85481208 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | morpholin-4-yl-[3-(phenylsulfanylmethyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]methanone |
| SMILES | O=C(N1CCOCC1)N1CCC2NNC(CSc3ccccc3)C2C1 |
| InChI | InChI=1S/C18H26N4O2S/c23-18(21-8-10-24-11-9-21)22-7-6-16-15(12-22)17(20-19-16)13-25-14-4-2-1-3-5-14/h1-5,15-17,19-20H,6-13H2 |
| InChIKey | DABGCBLXBUQWKH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |