C20H30N4O2S — CID 74574739
N-[3-methyl-1-oxo-1-[3-(phenylsulfanylmethyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]butan-2-yl]acetamide (PubChem CID 74574739) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-[3-methyl-1-oxo-1-[3-(phenylsulfanylmethyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]butan-2-yl]acetamide.
| Compound Name | N-[3-methyl-1-oxo-1-[3-(phenylsulfanylmethyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 74574739 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[3-methyl-1-oxo-1-[3-(phenylsulfanylmethyl)-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl]butan-2-yl]acetamide |
| SMILES | CC(=O)NC(C(=O)N1CCC2NNC(CSc3ccccc3)C2C1)C(C)C |
| InChI | InChI=1S/C20H30N4O2S/c1-13(2)19(21-14(3)25)20(26)24-10-9-17-16(11-24)18(23-22-17)12-27-15-7-5-4-6-8-15/h4-8,13,16-19,22-23H,9-12H2,1-3H3,(H,21,25) |
| InChIKey | AABTYBKDKVPMIA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |