C23H17N5O2S — CID 74507723
[6-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-thiophen-2-ylmethanone (PubChem CID 74507723) has the molecular formula C23H17N5O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is [6-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-thiophen-2-ylmethanone.
| Compound Name | [6-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 74507723 |
| Molecular Formula | C23H17N5O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [6-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1Cc2[nH]cnc2CC1c1nc(-c2ccc3ccccc3c2)no1 |
| InChI | InChI=1S/C23H17N5O2S/c29-23(20-6-3-9-31-20)28-12-18-17(24-13-25-18)11-19(28)22-26-21(27-30-22)16-8-7-14-4-1-2-5-15(14)10-16/h1-10,13,19H,11-12H2,(H,24,25) |
| InChIKey | CLHQXWAZYWFALD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |