C15H23NO3 — CID 74510191
3-propan-2-yl-4a,5,6,6a,7,8,9,10,10a,10b-decahydronaphtho[2,1-e][1,3]oxazine-2,4-dione (PubChem CID 74510191) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-propan-2-yl-4a,5,6,6a,7,8,9,10,10a,10b-decahydronaphtho[2,1-e][1,3]oxazine-2,4-dione.
| Compound Name | 3-propan-2-yl-4a,5,6,6a,7,8,9,10,10a,10b-decahydronaphtho[2,1-e][1,3]oxazine-2,4-dione |
|---|---|
| PubChem CID | 74510191 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-propan-2-yl-4a,5,6,6a,7,8,9,10,10a,10b-decahydronaphtho[2,1-e][1,3]oxazine-2,4-dione |
| SMILES | CC(C)N1C(=O)OC2C(CCC3CCCCC32)C1=O |
| InChI | InChI=1S/C15H23NO3/c1-9(2)16-14(17)12-8-7-10-5-3-4-6-11(10)13(12)19-15(16)18/h9-13H,3-8H2,1-2H3 |
| InChIKey | PSCHWVRRELZICF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |