C25H25NO4S — CID 74513423
1-(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 74513423) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 74513423 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1C=CC(=O)N1CCc2cc(OC)c(OC)cc2C1c1cccs1 |
| InChI | InChI=1S/C25H25NO4S/c1-28-20-8-5-4-7-17(20)10-11-24(27)26-13-12-18-15-21(29-2)22(30-3)16-19(18)25(26)23-9-6-14-31-23/h4-11,14-16,25H,12-13H2,1-3H3 |
| InChIKey | KOEAAKRXWPRCJL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|