C24H23NO3S — CID 42905413
(E)-1-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 42905413) has the molecular formula C24H23NO3S and a molecular weight of 405.52 g/mol. Its IUPAC name is (E)-1-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 42905413 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (E)-1-(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)N(C(=O)/C=C/c1cccs1)CC2 |
| InChI | InChI=1S/C24H23NO3S/c1-27-21-15-18-12-13-25(23(26)11-10-19-9-6-14-29-19)24(17-7-4-3-5-8-17)20(18)16-22(21)28-2/h3-11,14-16,24H,12-13H2,1-2H3/b11-10+ |
| InChIKey | LDPCVTMQYSSUSX-ZHACJKMWSA-N |
| XLogP | 4.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|