C22H27N5O4 — CID 7451750
(2S)-2-acetamido-3-(3-methylphenyl)-N-[1-(3-nitro-2-pyridinyl)piperidin-4-yl]propanamide (PubChem CID 7451750) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is (2S)-2-acetamido-3-(3-methylphenyl)-N-[1-(3-nitro-2-pyridinyl)piperidin-4-yl]propanamide.
| Compound Name | (2S)-2-acetamido-3-(3-methylphenyl)-N-[1-(3-nitro-2-pyridinyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 7451750 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (2S)-2-acetamido-3-(3-methylphenyl)-N-[1-(3-nitro-2-pyridinyl)piperidin-4-yl]propanamide |
| SMILES | CC(=O)N[C@@H](Cc1cccc(C)c1)C(=O)NC1CCN(c2ncccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H27N5O4/c1-15-5-3-6-17(13-15)14-19(24-16(2)28)22(29)25-18-8-11-26(12-9-18)21-20(27(30)31)7-4-10-23-21/h3-7,10,13,18-19H,8-9,11-12,14H2,1-2H3,(H,24,28)(H,25,29)/t19-/m0/s1 |
| InChIKey | AOAZEXIQQLXVMY-IBGZPJMESA-N |
| XLogP | 2.13 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|