C13H21O2- — CID 7452313
(4S)-4-hexylcyclohexene-1-carboxylate (PubChem CID 7452313) has the molecular formula C13H21O2- and a molecular weight of 209.31 g/mol. Its IUPAC name is (4S)-4-hexylcyclohexene-1-carboxylate.
| Compound Name | (4S)-4-hexylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 7452313 |
| Molecular Formula | C13H21O2- |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | (4S)-4-hexylcyclohexene-1-carboxylate |
| SMILES | CCCCCC[C@@H]1CC=C(C(=O)[O-])CC1 |
| InChI | InChI=1S/C13H22O2/c1-2-3-4-5-6-11-7-9-12(10-8-11)13(14)15/h9,11H,2-8,10H2,1H3,(H,14,15)/p-1/t11-/m1/s1 |
| InChIKey | QAISWPIMCXXRRD-LLVKDONJSA-M |
| XLogP | 2.43 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|