C23H24ClN5O5 — CID 74526408
2-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide (PubChem CID 74526408) has the molecular formula C23H24ClN5O5 and a molecular weight of 485.93 g/mol. Its IUPAC name is 2-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide.
| Compound Name | 2-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
|---|---|
| PubChem CID | 74526408 |
| Molecular Formula | C23H24ClN5O5 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropteridin-1-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| SMILES | O=C(CN1C(=O)N(Cc2ccccc2Cl)C(=O)C2NCCNC21)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H24ClN5O5/c24-16-4-2-1-3-14(16)12-29-22(31)20-21(26-8-7-25-20)28(23(29)32)13-19(30)27-15-5-6-17-18(11-15)34-10-9-33-17/h1-6,11,20-21,25-26H,7-10,12-13H2,(H,27,30) |
| InChIKey | KUPMIRRCKUNITG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |