C22H22FN5O4S — CID 74526607
ethyl 2-[[2-[[2-(4-fluorophenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 74526607) has the molecular formula C22H22FN5O4S and a molecular weight of 471.51 g/mol. Its IUPAC name is ethyl 2-[[2-[[2-(4-fluorophenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[[2-(4-fluorophenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 74526607 |
| Molecular Formula | C22H22FN5O4S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | ethyl 2-[[2-[[2-(4-fluorophenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CSC1=NNC(=O)C2CC(c3ccc(F)cc3)NN12 |
| InChI | InChI=1S/C22H22FN5O4S/c1-2-32-21(31)15-5-3-4-6-16(15)24-19(29)12-33-22-26-25-20(30)18-11-17(27-28(18)22)13-7-9-14(23)10-8-13/h3-10,17-18,27H,2,11-12H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | ANBWEKCWFSPBJV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |