C16H15FN4O2S — CID 74526651
7-[(3-fluorophenyl)methylsulfanyl]-2-(furan-2-yl)-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one (PubChem CID 74526651) has the molecular formula C16H15FN4O2S and a molecular weight of 346.39 g/mol. Its IUPAC name is 7-[(3-fluorophenyl)methylsulfanyl]-2-(furan-2-yl)-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one.
| Compound Name | 7-[(3-fluorophenyl)methylsulfanyl]-2-(furan-2-yl)-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 74526651 |
| Molecular Formula | C16H15FN4O2S |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 7-[(3-fluorophenyl)methylsulfanyl]-2-(furan-2-yl)-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one |
| SMILES | O=C1NN=C(SCc2cccc(F)c2)N2NC(c3ccco3)CC12 |
| InChI | InChI=1S/C16H15FN4O2S/c17-11-4-1-3-10(7-11)9-24-16-19-18-15(22)13-8-12(20-21(13)16)14-5-2-6-23-14/h1-7,12-13,20H,8-9H2,(H,18,22) |
| InChIKey | FHQYRSDHELJXGI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |