C26H32N4O6 — CID 74531825
6,7-dimethoxy-3-[5-[4-(4-methoxyphenyl)piperazin-1-yl]-5-oxopentyl]-4aH-quinazoline-2,4-dione (PubChem CID 74531825) has the molecular formula C26H32N4O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is 6,7-dimethoxy-3-[5-[4-(4-methoxyphenyl)piperazin-1-yl]-5-oxopentyl]-4aH-quinazoline-2,4-dione.
| Compound Name | 6,7-dimethoxy-3-[5-[4-(4-methoxyphenyl)piperazin-1-yl]-5-oxopentyl]-4aH-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 74531825 |
| Molecular Formula | C26H32N4O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 6,7-dimethoxy-3-[5-[4-(4-methoxyphenyl)piperazin-1-yl]-5-oxopentyl]-4aH-quinazoline-2,4-dione |
| SMILES | COC1=CC2=NC(=O)N(CCCCC(=O)N3CCN(c4ccc(OC)cc4)CC3)C(=O)C2C=C1OC |
| InChI | InChI=1S/C26H32N4O6/c1-34-19-9-7-18(8-10-19)28-12-14-29(15-13-28)24(31)6-4-5-11-30-25(32)20-16-22(35-2)23(36-3)17-21(20)27-26(30)33/h7-10,16-17,20H,4-6,11-15H2,1-3H3 |
| InChIKey | BKRWNOASUHTZCS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 100.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|