C26H32BrN5O4 — CID 75196755
4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]butanamide (PubChem CID 75196755) has the molecular formula C26H32BrN5O4 and a molecular weight of 558.48 g/mol. Its IUPAC name is 4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]butanamide.
| Compound Name | 4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]butanamide |
|---|---|
| PubChem CID | 75196755 |
| Molecular Formula | C26H32BrN5O4 |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]butanamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)CCCN3C(=O)N=C4C=CC(Br)=CC4C3=O)CC2)cc1 |
| InChI | InChI=1S/C26H32BrN5O4/c1-36-21-8-6-20(7-9-21)31-16-14-30(15-17-31)12-3-11-28-24(33)4-2-13-32-25(34)22-18-19(27)5-10-23(22)29-26(32)35/h5-10,18,22H,2-4,11-17H2,1H3,(H,28,33) |
| InChIKey | VJZGJMMLCHAKST-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|